About 2-amino-N,N-bis(2-hydroxyethyl)acetamide
2-amino-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 60954063) has the molecular formula C6H14N2O3
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N,N-bis(2-hydroxyethyl)acetamide |
| PubChem CID | 60954063 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-amino-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | NCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C6H14N2O3/c7-5-6(11)8(1-3-9)2-4-10/h9-10H,1-5,7H2 |
| InChIKey | JBDDMGRYUVEJCV-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N,N-bis(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-bis(2-hydroxyethyl)acetamide?
The IUPAC name of 2-amino-N,N-bis(2-hydroxyethyl)acetamide (CID 60954063) is 2-amino-N,N-bis(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-amino-N,N-bis(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-amino-N,N-bis(2-hydroxyethyl)acetamide is NCC(=O)N(CCO)CCO.
What is the InChIKey of 2-amino-N,N-bis(2-hydroxyethyl)acetamide?
The InChIKey is JBDDMGRYUVEJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3/c7-5-6(11)8(1-3-9)2-4-10/h9-10H,1-5,7H2.
What are the key properties of 2-amino-N,N-bis(2-hydroxyethyl)acetamide?
2-amino-N,N-bis(2-hydroxyethyl)acetamide has a molecular weight of 162.19 g/mol, XLogP of -2.24, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-bis(2-hydroxyethyl)acetamide is sourced from PubChem (CID 60954063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).