C15H20BrNO4 — CID 60954211
6-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-6-oxohexanoic acid (PubChem CID 60954211) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is 6-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 60954211 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 6-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-6-oxohexanoic acid |
| SMILES | COc1ccc(Br)cc1CN(C)C(=O)CCCCC(=O)O |
| InChI | InChI=1S/C15H20BrNO4/c1-17(14(18)5-3-4-6-15(19)20)10-11-9-12(16)7-8-13(11)21-2/h7-9H,3-6,10H2,1-2H3,(H,19,20) |
| InChIKey | TYFPMNFIYCTBHQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|