C14H17BrN4O2 — CID 60955985
4-bromo-N-[4-(dimethylamino)-2-methoxy-3-pyridinyl]-1-methylpyrrole-2-carboxamide (PubChem CID 60955985) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 4-bromo-N-[4-(dimethylamino)-2-methoxy-3-pyridinyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[4-(dimethylamino)-2-methoxy-3-pyridinyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60955985 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 4-bromo-N-[4-(dimethylamino)-2-methoxy-3-pyridinyl]-1-methylpyrrole-2-carboxamide |
| SMILES | COc1nccc(N(C)C)c1NC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C14H17BrN4O2/c1-18(2)10-5-6-16-14(21-4)12(10)17-13(20)11-7-9(15)8-19(11)3/h5-8H,1-4H3,(H,17,20) |
| InChIKey | NXQOEOBXTOWMIY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |