C16H22FNO3 — CID 60956642
2-(4-fluorophenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 60956642) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 2-(4-fluorophenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 60956642 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(4-fluorophenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)(Oc1ccc(F)cc1)C(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C16H22FNO3/c1-16(2,21-14-5-3-13(17)4-6-14)15(20)18-9-7-12(11-19)8-10-18/h3-6,12,19H,7-11H2,1-2H3 |
| InChIKey | JCENBQLAMQFOCM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |