C9H13N3O2S — CID 60958313
[4-(hydroxymethyl)piperidin-1-yl]-(thiadiazol-5-yl)methanone (PubChem CID 60958313) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is [4-(hydroxymethyl)piperidin-1-yl]-(thiadiazol-5-yl)methanone.
| Compound Name | [4-(hydroxymethyl)piperidin-1-yl]-(thiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 60958313 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | [4-(hydroxymethyl)piperidin-1-yl]-(thiadiazol-5-yl)methanone |
| SMILES | O=C(c1cnns1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C9H13N3O2S/c13-6-7-1-3-12(4-2-7)9(14)8-5-10-11-15-8/h5,7,13H,1-4,6H2 |
| InChIKey | BXXJZFYNOCXSOJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |