C10H19ClN2O2S — CID 60959425
3-chloro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)propane-1-sulfonamide (PubChem CID 60959425) has the molecular formula C10H19ClN2O2S and a molecular weight of 266.79 g/mol. Its IUPAC name is 3-chloro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60959425 |
| Molecular Formula | C10H19ClN2O2S |
| Molecular Weight | 266.79 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-chloro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NC1CCN2CCCC12 |
| InChI | InChI=1S/C10H19ClN2O2S/c11-5-2-8-16(14,15)12-9-4-7-13-6-1-3-10(9)13/h9-10,12H,1-8H2 |
| InChIKey | ZBWXIEIBIMFXNT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.79 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|