C11H15F3N2O3S — CID 60959811
N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide (PubChem CID 60959811) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide.
| Compound Name | N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60959811 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide |
| SMILES | CCCCN(CC(F)(F)F)S(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C11H15F3N2O3S/c1-2-3-6-16(8-11(12,13)14)20(18,19)9-4-5-10(17)15-7-9/h4-5,7H,2-3,6,8H2,1H3,(H,15,17) |
| InChIKey | XWHAMAFHTXXRQA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |