About N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide
N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide (PubChem CID 60960230) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 60960230 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)N(CCO)C1CCN(C)CC1 |
| InChI | InChI=1S/C14H24N4O2/c1-10-13(11(2)16-15-10)14(20)18(8-9-19)12-4-6-17(3)7-5-12/h12,19H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | MHOSSPWLIOHIFP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide (CID 60960230) is N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide is Cc1n[nH]c(C)c1C(=O)N(CCO)C1CCN(C)CC1.
What is the InChIKey of N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide?
The InChIKey is MHOSSPWLIOHIFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-10-13(11(2)16-15-10)14(20)18(8-9-19)12-4-6-17(3)7-5-12/h12,19H,4-9H2,1-3H3,(H,15,16).
What are the key properties of N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide?
N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide has a molecular weight of 280.37 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-3,5-dimethyl-N-(1-methylpiperidin-4-yl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 60960230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).