C8H19N3O — CID 60961694
3-[2-hydroxyethyl(methyl)amino]pentanimidamide (PubChem CID 60961694) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(methyl)amino]pentanimidamide.
| Compound Name | 3-[2-hydroxyethyl(methyl)amino]pentanimidamide |
|---|---|
| PubChem CID | 60961694 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 3-[2-hydroxyethyl(methyl)amino]pentanimidamide |
| SMILES | [H]/N=C(\N)CC(CC)N(C)CCO |
| InChI | InChI=1S/C8H19N3O/c1-3-7(6-8(9)10)11(2)4-5-12/h7,12H,3-6H2,1-2H3,(H3,9,10) |
| InChIKey | CTBQUUJZFFOLGF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|