C14H26N4O3 — CID 60962649
2-amino-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]-N-methylbutanediamide (PubChem CID 60962649) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-amino-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]-N-methylbutanediamide.
| Compound Name | 2-amino-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]-N-methylbutanediamide |
|---|---|
| PubChem CID | 60962649 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-amino-N-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]-N-methylbutanediamide |
| SMILES | CN(CC(=O)N(C)C1CCCCC1)C(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C14H26N4O3/c1-17(14(21)11(15)8-12(16)19)9-13(20)18(2)10-6-4-3-5-7-10/h10-11H,3-9,15H2,1-2H3,(H2,16,19) |
| InChIKey | WXQVVGQMCYMSAB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |