About 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide
4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 60962880) has the molecular formula C9H18N4O2
and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide |
| PubChem CID | 60962880 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(C(=O)CN)CC1 |
| InChI | InChI=1S/C9H18N4O2/c1-11(2)9(15)13-5-3-12(4-6-13)8(14)7-10/h3-7,10H2,1-2H3 |
| InChIKey | MZPQMMXAIRCELT-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide?
The IUPAC name of 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide (CID 60962880) is 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide.
What is the SMILES notation for 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide?
The canonical SMILES for 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide is CN(C)C(=O)N1CCN(C(=O)CN)CC1.
What is the InChIKey of 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide?
The InChIKey is MZPQMMXAIRCELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2/c1-11(2)9(15)13-5-3-12(4-6-13)8(14)7-10/h3-7,10H2,1-2H3.
What are the key properties of 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide?
4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide has a molecular weight of 214.27 g/mol, XLogP of -1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoacetyl)-N,N-dimethylpiperazine-1-carboxamide is sourced from PubChem (CID 60962880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).