C14H26N4O2 — CID 60963214
2-[4-[2-(cyclopentylamino)acetyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 60963214) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[4-[2-(cyclopentylamino)acetyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-[2-(cyclopentylamino)acetyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 60963214 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-[4-[2-(cyclopentylamino)acetyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCN(C(=O)CNC2CCCC2)CC1 |
| InChI | InChI=1S/C14H26N4O2/c15-13(19)11-17-6-3-7-18(9-8-17)14(20)10-16-12-4-1-2-5-12/h12,16H,1-11H2,(H2,15,19) |
| InChIKey | LGPZZRPIFBHASB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |