About N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide
N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide (PubChem CID 60963240) has the molecular formula C13H22N4O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide.
Molecular Properties
| Compound Name | N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide |
| PubChem CID | 60963240 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)N(C)Cc1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H22N4O3/c1-14-7-5-6-11(18)15(2)8-10-9-16(3)13(20)17(4)12(10)19/h9,14H,5-8H2,1-4H3 |
| InChIKey | KLUFUJKVZHMBFY-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide?
The IUPAC name of N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide (CID 60963240) is N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide.
What is the SMILES notation for N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide?
The canonical SMILES for N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide is CNCCCC(=O)N(C)Cc1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide?
The InChIKey is KLUFUJKVZHMBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O3/c1-14-7-5-6-11(18)15(2)8-10-9-16(3)13(20)17(4)12(10)19/h9,14H,5-8H2,1-4H3.
What are the key properties of N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide?
N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide has a molecular weight of 282.34 g/mol, XLogP of -0.96, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methyl-4-(methylamino)butanamide is sourced from PubChem (CID 60963240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).