C16H20N4O — CID 60964745
N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]ethyl]-4-methylbenzamide (PubChem CID 60964745) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 60964745 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2cc(C)nc(C)n2)cc1 |
| InChI | InChI=1S/C16H20N4O/c1-11-4-6-14(7-5-11)16(21)18-9-8-17-15-10-12(2)19-13(3)20-15/h4-7,10H,8-9H2,1-3H3,(H,18,21)(H,17,19,20) |
| InChIKey | JJPCYBHBWOTQJB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|