About 1-ethyl-3,5-dipropyladamantane
1-ethyl-3,5-dipropyladamantane (PubChem CID 609649) has the molecular formula C18H32
and a molecular weight of 248.45 g/mol. Its IUPAC name is 1-ethyl-3,5-dipropyladamantane.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dipropyladamantane |
| PubChem CID | 609649 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 1-ethyl-3,5-dipropyladamantane |
| SMILES | CCCC12CC3CC(CC)(C1)CC(CCC)(C3)C2 |
| InChI | InChI=1S/C18H32/c1-4-7-17-10-15-9-16(6-3,12-17)13-18(11-15,14-17)8-5-2/h15H,4-14H2,1-3H3 |
| InChIKey | OFZCNEUHWGCIDP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-3,5-dipropyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dipropyladamantane?
The IUPAC name of 1-ethyl-3,5-dipropyladamantane (CID 609649) is 1-ethyl-3,5-dipropyladamantane.
What is the SMILES notation for 1-ethyl-3,5-dipropyladamantane?
The canonical SMILES for 1-ethyl-3,5-dipropyladamantane is CCCC12CC3CC(CC)(C1)CC(CCC)(C3)C2.
What is the InChIKey of 1-ethyl-3,5-dipropyladamantane?
The InChIKey is OFZCNEUHWGCIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32/c1-4-7-17-10-15-9-16(6-3,12-17)13-18(11-15,14-17)8-5-2/h15H,4-14H2,1-3H3.
What are the key properties of 1-ethyl-3,5-dipropyladamantane?
1-ethyl-3,5-dipropyladamantane has a molecular weight of 248.45 g/mol, XLogP of 5.95, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dipropyladamantane is sourced from PubChem (CID 609649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).