C5H9N5O2 — CID 60965764
6-(2-aminoethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 60965764) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2-aminoethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60965764 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 6-(2-aminoethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | NCCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H9N5O2/c6-1-2-7-3-4(11)8-5(12)10-9-3/h1-2,6H2,(H,7,9)(H2,8,10,11,12) |
| InChIKey | CQZSDFPZPMHNGG-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |