C12H21NO2 — CID 60965924
3-[(5-methylfuran-2-yl)methyl-propan-2-ylamino]propan-1-ol (PubChem CID 60965924) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-[(5-methylfuran-2-yl)methyl-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[(5-methylfuran-2-yl)methyl-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 60965924 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-[(5-methylfuran-2-yl)methyl-propan-2-ylamino]propan-1-ol |
| SMILES | Cc1ccc(CN(CCCO)C(C)C)o1 |
| InChI | InChI=1S/C12H21NO2/c1-10(2)13(7-4-8-14)9-12-6-5-11(3)15-12/h5-6,10,14H,4,7-9H2,1-3H3 |
| InChIKey | FMYFVXQKUJCXJP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |