About N-(2-aminoethyl)-1,2-oxazole-5-carboxamide
N-(2-aminoethyl)-1,2-oxazole-5-carboxamide (PubChem CID 60966581) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1,2-oxazole-5-carboxamide |
| PubChem CID | 60966581 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(2-aminoethyl)-1,2-oxazole-5-carboxamide |
| SMILES | NCCNC(=O)c1ccno1 |
| InChI | InChI=1S/C6H9N3O2/c7-2-4-8-6(10)5-1-3-9-11-5/h1,3H,2,4,7H2,(H,8,10) |
| InChIKey | WJLJRRABKPMKAE-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(2-aminoethyl)-1,2-oxazole-5-carboxamide (CID 60966581) is N-(2-aminoethyl)-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-1,2-oxazole-5-carboxamide is NCCNC(=O)c1ccno1.
What is the InChIKey of N-(2-aminoethyl)-1,2-oxazole-5-carboxamide?
The InChIKey is WJLJRRABKPMKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c7-2-4-8-6(10)5-1-3-9-11-5/h1,3H,2,4,7H2,(H,8,10).
What are the key properties of N-(2-aminoethyl)-1,2-oxazole-5-carboxamide?
N-(2-aminoethyl)-1,2-oxazole-5-carboxamide has a molecular weight of 155.16 g/mol, XLogP of -0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 60966581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).