C10H14N6O — CID 609674
2-(diethylamino)-4-oxo-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-8-carbonitrile (PubChem CID 609674) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(diethylamino)-4-oxo-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-8-carbonitrile.
| Compound Name | 2-(diethylamino)-4-oxo-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-8-carbonitrile |
|---|---|
| PubChem CID | 609674 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-(diethylamino)-4-oxo-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-8-carbonitrile |
| SMILES | CCN(CC)c1nc2n(c(=O)n1)CCN2C#N |
| InChI | InChI=1S/C10H14N6O/c1-3-14(4-2)8-12-9-15(7-11)5-6-16(9)10(17)13-8/h3-6H2,1-2H3 |
| InChIKey | ZAYRIYXVYKSJJG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|