C15H14N4O4 — CID 6096796
7-piperidin-4-yl-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone (PubChem CID 6096796) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 7-piperidin-4-yl-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone.
| Compound Name | 7-piperidin-4-yl-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
|---|---|
| PubChem CID | 6096796 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 7-piperidin-4-yl-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
| SMILES | O=c1c2[nH]cc[nH]c2c(=O)c2c(=O)n(C3CCNCC3)c(=O)c12 |
| InChI | InChI=1S/C15H14N4O4/c20-12-8-9(13(21)11-10(12)17-5-6-18-11)15(23)19(14(8)22)7-1-3-16-4-2-7/h5-7,16-18H,1-4H2 |
| InChIKey | IXNMNWSSOIPTSN-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|