C17H9N3O6 — CID 6096801
7-(1,3-benzodioxol-5-yl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone (PubChem CID 6096801) has the molecular formula C17H9N3O6 and a molecular weight of 351.27 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
|---|---|
| PubChem CID | 6096801 |
| Molecular Formula | C17H9N3O6 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
| SMILES | O=c1c2[nH]cc[nH]c2c(=O)c2c(=O)n(-c3ccc4c(c3)OCO4)c(=O)c12 |
| InChI | InChI=1S/C17H9N3O6/c21-14-10-11(15(22)13-12(14)18-3-4-19-13)17(24)20(16(10)23)7-1-2-8-9(5-7)26-6-25-8/h1-5,18-19H,6H2 |
| InChIKey | YUDCDSHADUJZIO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|