C18H11N3O6 — CID 6096802
7-(1,3-benzodioxol-5-ylmethyl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone (PubChem CID 6096802) has the molecular formula C18H11N3O6 and a molecular weight of 365.30 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-ylmethyl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone.
| Compound Name | 7-(1,3-benzodioxol-5-ylmethyl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
|---|---|
| PubChem CID | 6096802 |
| Molecular Formula | C18H11N3O6 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 7-(1,3-benzodioxol-5-ylmethyl)-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
| SMILES | O=c1c2[nH]cc[nH]c2c(=O)c2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)c12 |
| InChI | InChI=1S/C18H11N3O6/c22-15-11-12(16(23)14-13(15)19-3-4-20-14)18(25)21(17(11)24)6-8-1-2-9-10(5-8)27-7-26-9/h1-5,19-20H,6-7H2 |
| InChIKey | FKFCNJHQZVZBPY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|