C17H9ClFN3O4 — CID 6096818
7-[(3-chloro-4-fluorophenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone (PubChem CID 6096818) has the molecular formula C17H9ClFN3O4 and a molecular weight of 373.73 g/mol. Its IUPAC name is 7-[(3-chloro-4-fluorophenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone.
| Compound Name | 7-[(3-chloro-4-fluorophenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
|---|---|
| PubChem CID | 6096818 |
| Molecular Formula | C17H9ClFN3O4 |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 7-[(3-chloro-4-fluorophenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
| SMILES | O=c1c2[nH]cc[nH]c2c(=O)c2c(=O)n(Cc3ccc(F)c(Cl)c3)c(=O)c12 |
| InChI | InChI=1S/C17H9ClFN3O4/c18-8-5-7(1-2-9(8)19)6-22-16(25)10-11(17(22)26)15(24)13-12(14(10)23)20-3-4-21-13/h1-5,20-21H,6H2 |
| InChIKey | OIWYXNCCAWASTI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|