C13H14F3N3O — CID 60968938
2-[2-(2,2,2-trifluoroethoxy)ethylamino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 60968938) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethylamino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethylamino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 60968938 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethylamino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1NCCOCC(F)(F)F)CCC2 |
| InChI | InChI=1S/C13H14F3N3O/c14-13(15,16)8-20-5-4-18-12-10(7-17)6-9-2-1-3-11(9)19-12/h6H,1-5,8H2,(H,18,19) |
| InChIKey | YLVQMQYJNHPTED-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|