C10H19N3O — CID 60969371
2-[3-cyanopropyl(2-methylpropyl)amino]acetamide (PubChem CID 60969371) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[3-cyanopropyl(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[3-cyanopropyl(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 60969371 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-[3-cyanopropyl(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CCCC#N)CC(N)=O |
| InChI | InChI=1S/C10H19N3O/c1-9(2)7-13(8-10(12)14)6-4-3-5-11/h9H,3-4,6-8H2,1-2H3,(H2,12,14) |
| InChIKey | YMIMRVWTCYDHFB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|