About N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide
N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide (PubChem CID 60969558) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide.
Molecular Properties
| Compound Name | N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide |
| PubChem CID | 60969558 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)Nc1n[nH]c2ccccc12)CC(C)(C)C |
| InChI | InChI=1S/C16H23N3O/c1-11(10-16(2,3)4)9-14(20)17-15-12-7-5-6-8-13(12)18-19-15/h5-8,11H,9-10H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | YMGNTWYHFWBTRI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide?
The IUPAC name of N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide (CID 60969558) is N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide.
What is the SMILES notation for N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide?
The canonical SMILES for N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide is CC(CC(=O)Nc1n[nH]c2ccccc12)CC(C)(C)C.
What is the InChIKey of N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide?
The InChIKey is YMGNTWYHFWBTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-11(10-16(2,3)4)9-14(20)17-15-12-7-5-6-8-13(12)18-19-15/h5-8,11H,9-10H2,1-4H3,(H2,17,18,19,20).
What are the key properties of N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide?
N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide has a molecular weight of 273.38 g/mol, XLogP of 3.96, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-3-yl)-3,5,5-trimethylhexanamide is sourced from PubChem (CID 60969558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).