C15H24BrNO2S — CID 60970678
1-[(4-bromothiophen-2-yl)methylamino]-3-(3-methylcyclohexyl)oxypropan-2-ol (PubChem CID 60970678) has the molecular formula C15H24BrNO2S and a molecular weight of 362.33 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methylamino]-3-(3-methylcyclohexyl)oxypropan-2-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methylamino]-3-(3-methylcyclohexyl)oxypropan-2-ol |
|---|---|
| PubChem CID | 60970678 |
| Molecular Formula | C15H24BrNO2S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methylamino]-3-(3-methylcyclohexyl)oxypropan-2-ol |
| SMILES | CC1CCCC(OCC(O)CNCc2cc(Br)cs2)C1 |
| InChI | InChI=1S/C15H24BrNO2S/c1-11-3-2-4-14(5-11)19-9-13(18)7-17-8-15-6-12(16)10-20-15/h6,10-11,13-14,17-18H,2-5,7-9H2,1H3 |
| InChIKey | JLGINIWXALSTME-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |