C15H22N2O4 — CID 60970804
ethyl 2-[3-(tert-butylcarbamoylamino)phenoxy]acetate (PubChem CID 60970804) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl 2-[3-(tert-butylcarbamoylamino)phenoxy]acetate.
| Compound Name | ethyl 2-[3-(tert-butylcarbamoylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 60970804 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethyl 2-[3-(tert-butylcarbamoylamino)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-5-20-13(18)10-21-12-8-6-7-11(9-12)16-14(19)17-15(2,3)4/h6-9H,5,10H2,1-4H3,(H2,16,17,19) |
| InChIKey | IFZJXXVHHDUQCF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |