About 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide
6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide (PubChem CID 60972270) has the molecular formula C10H9N3O2S
and a molecular weight of 235.27 g/mol. Its IUPAC name is 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide |
| PubChem CID | 60972270 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1nccs1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C10H9N3O2S/c14-8-2-1-7(5-12-8)10(15)13-6-9-11-3-4-16-9/h1-5H,6H2,(H,12,14)(H,13,15) |
| InChIKey | USUKLTCTRNAIHY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide?
The IUPAC name of 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide (CID 60972270) is 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide.
What is the SMILES notation for 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide?
The canonical SMILES for 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide is O=C(NCc1nccs1)c1ccc(=O)[nH]c1.
What is the InChIKey of 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide?
The InChIKey is USUKLTCTRNAIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S/c14-8-2-1-7(5-12-8)10(15)13-6-9-11-3-4-16-9/h1-5H,6H2,(H,12,14)(H,13,15).
What are the key properties of 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide?
6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide has a molecular weight of 235.27 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-(1,3-thiazol-2-ylmethyl)-1H-pyridine-3-carboxamide is sourced from PubChem (CID 60972270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).