C13H12F2N2O3 — CID 60972692
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine (PubChem CID 60972692) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 60972692 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine |
| SMILES | Cc1nc(CNc2ccc3c(c2)OC(F)(F)O3)oc1C |
| InChI | InChI=1S/C13H12F2N2O3/c1-7-8(2)18-12(17-7)6-16-9-3-4-10-11(5-9)20-13(14,15)19-10/h3-5,16H,6H2,1-2H3 |
| InChIKey | XZEBLZCHAUYMIL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|