C16H20N2O2S — CID 60972705
N-(3-amino-2,4-dimethylphenyl)-3,5-dimethylbenzenesulfonamide (PubChem CID 60972705) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-(3-amino-2,4-dimethylphenyl)-3,5-dimethylbenzenesulfonamide.
| Compound Name | N-(3-amino-2,4-dimethylphenyl)-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 60972705 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(3-amino-2,4-dimethylphenyl)-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)Nc2ccc(C)c(N)c2C)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-10-7-11(2)9-14(8-10)21(19,20)18-15-6-5-12(3)16(17)13(15)4/h5-9,18H,17H2,1-4H3 |
| InChIKey | ZBCGGMMLXHEGMO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|