About 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium
1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium (PubChem CID 6097359) has the molecular formula C14H29N3Sn
and a molecular weight of 358.12 g/mol. Its IUPAC name is 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium.
Molecular Properties
| Compound Name | 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium |
| PubChem CID | 6097359 |
| Molecular Formula | C14H29N3Sn |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium |
| SMILES | CCCC[Sn+](CCCC)CCCC.c1nnc[n-]1 |
| InChI | InChI=1S/3C4H9.C2H2N3.Sn/c3*1-3-4-2;1-3-2-5-4-1;/h3*1,3-4H2,2H3;1-2H;/q;;;-1;+1 |
| InChIKey | DGYNCAVWPOMYSI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium?
The IUPAC name of 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium (CID 6097359) is 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium.
What is the SMILES notation for 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium?
The canonical SMILES for 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium is CCCC[Sn+](CCCC)CCCC.c1nnc[n-]1.
What is the InChIKey of 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium?
The InChIKey is DGYNCAVWPOMYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C2H2N3.Sn/c3*1-3-4-2;1-3-2-5-4-1;/h3*1,3-4H2,2H3;1-2H;/q;;;-1;+1.
What are the key properties of 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium?
1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium has a molecular weight of 358.12 g/mol, XLogP of 4.32, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diaza-4-azanidacyclopenta-2,5-diene;tributylstannanylium is sourced from PubChem (CID 6097359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).