C9H17N3O2 — CID 60973782
N-(2-aminoethyl)-2-(2-methylpyrrolidin-1-yl)-2-oxoacetamide (PubChem CID 60973782) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(2-methylpyrrolidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(2-aminoethyl)-2-(2-methylpyrrolidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 60973782 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-(2-aminoethyl)-2-(2-methylpyrrolidin-1-yl)-2-oxoacetamide |
| SMILES | CC1CCCN1C(=O)C(=O)NCCN |
| InChI | InChI=1S/C9H17N3O2/c1-7-3-2-6-12(7)9(14)8(13)11-5-4-10/h7H,2-6,10H2,1H3,(H,11,13) |
| InChIKey | YUYFNHHKEIAVIG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|