C10H6F2N4O3 — CID 60974663
1-(2,4-difluorophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 60974663) has the molecular formula C10H6F2N4O3 and a molecular weight of 268.18 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 60974663 |
| Molecular Formula | C10H6F2N4O3 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H6F2N4O3/c11-6-1-2-7(8(12)3-6)9(17)4-15-5-13-10(14-15)16(18)19/h1-3,5H,4H2 |
| InChIKey | MRVUFVYAMYDWMI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|