About 4-(2,2-dimethoxyethyl)morpholine-3,5-dione
4-(2,2-dimethoxyethyl)morpholine-3,5-dione (PubChem CID 60976068) has the molecular formula C8H13NO5
and a molecular weight of 203.19 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethyl)morpholine-3,5-dione.
Molecular Properties
| Compound Name | 4-(2,2-dimethoxyethyl)morpholine-3,5-dione |
| PubChem CID | 60976068 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-(2,2-dimethoxyethyl)morpholine-3,5-dione |
| SMILES | COC(CN1C(=O)COCC1=O)OC |
| InChI | InChI=1S/C8H13NO5/c1-12-8(13-2)3-9-6(10)4-14-5-7(9)11/h8H,3-5H2,1-2H3 |
| InChIKey | RHVUGYKREQBLGN-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethoxyethyl)morpholine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethoxyethyl)morpholine-3,5-dione?
The IUPAC name of 4-(2,2-dimethoxyethyl)morpholine-3,5-dione (CID 60976068) is 4-(2,2-dimethoxyethyl)morpholine-3,5-dione.
What is the SMILES notation for 4-(2,2-dimethoxyethyl)morpholine-3,5-dione?
The canonical SMILES for 4-(2,2-dimethoxyethyl)morpholine-3,5-dione is COC(CN1C(=O)COCC1=O)OC.
What is the InChIKey of 4-(2,2-dimethoxyethyl)morpholine-3,5-dione?
The InChIKey is RHVUGYKREQBLGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-12-8(13-2)3-9-6(10)4-14-5-7(9)11/h8H,3-5H2,1-2H3.
What are the key properties of 4-(2,2-dimethoxyethyl)morpholine-3,5-dione?
4-(2,2-dimethoxyethyl)morpholine-3,5-dione has a molecular weight of 203.19 g/mol, XLogP of -1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethoxyethyl)morpholine-3,5-dione is sourced from PubChem (CID 60976068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).