About 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide (PubChem CID 60976457) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide.
Molecular Properties
| Compound Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide |
| PubChem CID | 60976457 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide |
| SMILES | Cc1csc(=O)n1CCCC(=O)NCc1ccn[nH]1 |
| InChI | InChI=1S/C12H16N4O2S/c1-9-8-19-12(18)16(9)6-2-3-11(17)13-7-10-4-5-14-15-10/h4-5,8H,2-3,6-7H2,1H3,(H,13,17)(H,14,15) |
| InChIKey | QGJQGDYNKKXOGP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide?
The IUPAC name of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide (CID 60976457) is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide.
What is the SMILES notation for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide?
The canonical SMILES for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide is Cc1csc(=O)n1CCCC(=O)NCc1ccn[nH]1.
What is the InChIKey of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide?
The InChIKey is QGJQGDYNKKXOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c1-9-8-19-12(18)16(9)6-2-3-11(17)13-7-10-4-5-14-15-10/h4-5,8H,2-3,6-7H2,1H3,(H,13,17)(H,14,15).
What are the key properties of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide?
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide has a molecular weight of 280.35 g/mol, XLogP of 1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(1H-pyrazol-5-ylmethyl)butanamide is sourced from PubChem (CID 60976457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).