About 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione
1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione (PubChem CID 60976710) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione |
| PubChem CID | 60976710 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione |
| SMILES | CC(c1nncn1C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H10N4O2/c1-6(9-11-10-5-12(9)2)13-7(14)3-4-8(13)15/h3-6H,1-2H3 |
| InChIKey | RMGIDQMACTWBCV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione?
The IUPAC name of 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione (CID 60976710) is 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione.
What is the SMILES notation for 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione?
The canonical SMILES for 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione is CC(c1nncn1C)N1C(=O)C=CC1=O.
What is the InChIKey of 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione?
The InChIKey is RMGIDQMACTWBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-6(9-11-10-5-12(9)2)13-7(14)3-4-8(13)15/h3-6H,1-2H3.
What are the key properties of 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione?
1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione has a molecular weight of 206.20 g/mol, XLogP of -0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione is sourced from PubChem (CID 60976710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).