C10H14N2O3 — CID 60976863
N,N-dimethyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 60976863) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N,N-dimethyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 60976863 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N,N-dimethyl-2-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CC1=CC(=O)N(C(C)C(=O)N(C)C)C1=O |
| InChI | InChI=1S/C10H14N2O3/c1-6-5-8(13)12(9(6)14)7(2)10(15)11(3)4/h5,7H,1-4H3 |
| InChIKey | NPSUCKSHMZPFKE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|