C15H14BrN3OS — CID 60977090
2-[(5-bromothiophen-3-yl)methyl-methylamino]-N-(4-cyanophenyl)acetamide (PubChem CID 60977090) has the molecular formula C15H14BrN3OS and a molecular weight of 364.27 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methyl-methylamino]-N-(4-cyanophenyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-N-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 60977090 |
| Molecular Formula | C15H14BrN3OS |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methyl-methylamino]-N-(4-cyanophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(C#N)cc1)Cc1csc(Br)c1 |
| InChI | InChI=1S/C15H14BrN3OS/c1-19(8-12-6-14(16)21-10-12)9-15(20)18-13-4-2-11(7-17)3-5-13/h2-6,10H,8-9H2,1H3,(H,18,20) |
| InChIKey | YOWDEFCOGJXZIR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |