C9H12N4O2 — CID 60977442
1-(1H-1,2,4-triazol-5-ylmethyl)azepane-2,7-dione (PubChem CID 60977442) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-ylmethyl)azepane-2,7-dione.
| Compound Name | 1-(1H-1,2,4-triazol-5-ylmethyl)azepane-2,7-dione |
|---|---|
| PubChem CID | 60977442 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-ylmethyl)azepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)N1Cc1ncn[nH]1 |
| InChI | InChI=1S/C9H12N4O2/c14-8-3-1-2-4-9(15)13(8)5-7-10-6-11-12-7/h6H,1-5H2,(H,10,11,12) |
| InChIKey | LCAXUCNFQXSOKS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|