About 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine
1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine (PubChem CID 60977551) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
| PubChem CID | 60977551 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
| SMILES | c1csc(CNCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H10N4S/c1-2-7(13-3-1)4-9-5-8-10-6-11-12-8/h1-3,6,9H,4-5H2,(H,10,11,12) |
| InChIKey | NGZUEBZCSLBIPL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
The IUPAC name of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine (CID 60977551) is 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine.
What is the SMILES notation for 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
The canonical SMILES for 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine is c1csc(CNCc2ncn[nH]2)c1.
What is the InChIKey of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
The InChIKey is NGZUEBZCSLBIPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-2-7(13-3-1)4-9-5-8-10-6-11-12-8/h1-3,6,9H,4-5H2,(H,10,11,12).
What are the key properties of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine has a molecular weight of 194.26 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine is sourced from PubChem (CID 60977551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).