About 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine
1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine (PubChem CID 60977823) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
| PubChem CID | 60977823 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
| SMILES | c1n[nH]c(CNCC2CCOC2)n1 |
| InChI | InChI=1S/C8H14N4O/c1-2-13-5-7(1)3-9-4-8-10-6-11-12-8/h6-7,9H,1-5H2,(H,10,11,12) |
| InChIKey | ANXXVFQTPZKJRU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
The IUPAC name of 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine (CID 60977823) is 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine.
What is the SMILES notation for 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
The canonical SMILES for 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine is c1n[nH]c(CNCC2CCOC2)n1.
What is the InChIKey of 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
The InChIKey is ANXXVFQTPZKJRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-2-13-5-7(1)3-9-4-8-10-6-11-12-8/h6-7,9H,1-5H2,(H,10,11,12).
What are the key properties of 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine?
1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine has a molecular weight of 182.23 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine is sourced from PubChem (CID 60977823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).