About 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole
4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole (PubChem CID 60978005) has the molecular formula C9H6ClF3N2
and a molecular weight of 234.61 g/mol. Its IUPAC name is 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole |
| PubChem CID | 60978005 |
| Molecular Formula | C9H6ClF3N2 |
| Molecular Weight | 234.61 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)Cc1nc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C9H6ClF3N2/c10-5-2-1-3-6-8(5)15-7(14-6)4-9(11,12)13/h1-3H,4H2,(H,14,15) |
| InChIKey | SXNAXSRVIIWZQT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole?
The IUPAC name of 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole (CID 60978005) is 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole.
What is the SMILES notation for 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole?
The canonical SMILES for 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole is FC(F)(F)Cc1nc2c(Cl)cccc2[nH]1.
What is the InChIKey of 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole?
The InChIKey is SXNAXSRVIIWZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF3N2/c10-5-2-1-3-6-8(5)15-7(14-6)4-9(11,12)13/h1-3H,4H2,(H,14,15).
What are the key properties of 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole?
4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole has a molecular weight of 234.61 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole is sourced from PubChem (CID 60978005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).