C10H9F3N4O2S — CID 60978228
N-(1H-1,2,4-triazol-5-ylmethyl)-4-(trifluoromethylsulfonyl)aniline (PubChem CID 60978228) has the molecular formula C10H9F3N4O2S and a molecular weight of 306.27 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 60978228 |
| Molecular Formula | C10H9F3N4O2S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)-4-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCc2ncn[nH]2)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N4O2S/c11-10(12,13)20(18,19)8-3-1-7(2-4-8)14-5-9-15-6-16-17-9/h1-4,6,14H,5H2,(H,15,16,17) |
| InChIKey | ANRXSTVYCJKYJU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |