C16H12F2N2 — CID 60978770
2-(2,3-dihydro-1H-inden-5-yl)-5,6-difluoro-1H-benzimidazole (PubChem CID 60978770) has the molecular formula C16H12F2N2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-5,6-difluoro-1H-benzimidazole.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-5,6-difluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 60978770 |
| Molecular Formula | C16H12F2N2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-5,6-difluoro-1H-benzimidazole |
| SMILES | Fc1cc2nc(-c3ccc4c(c3)CCC4)[nH]c2cc1F |
| InChI | InChI=1S/C16H12F2N2/c17-12-7-14-15(8-13(12)18)20-16(19-14)11-5-4-9-2-1-3-10(9)6-11/h4-8H,1-3H2,(H,19,20) |
| InChIKey | VXJPORKJUXHEKS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |