About ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate
ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate (PubChem CID 609789) has the molecular formula C21H27NO4S
and a molecular weight of 389.52 g/mol. Its IUPAC name is ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
| PubChem CID | 609789 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)c1c(C)cc(C)cc1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-6-26-20(23)13-19(18-9-7-14(2)8-10-18)22-27(24,25)21-16(4)11-15(3)12-17(21)5/h7-12,19,22H,6,13H2,1-5H3 |
| InChIKey | NVJLKGKLZLJNLO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
The IUPAC name of ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate (CID 609789) is ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate.
What is the SMILES notation for ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
The canonical SMILES for ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate is CCOC(=O)CC(NS(=O)(=O)c1c(C)cc(C)cc1C)c1ccc(C)cc1.
What is the InChIKey of ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
The InChIKey is NVJLKGKLZLJNLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO4S/c1-6-26-20(23)13-19(18-9-7-14(2)8-10-18)22-27(24,25)21-16(4)11-15(3)12-17(21)5/h7-12,19,22H,6,13H2,1-5H3.
What are the key properties of ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate has a molecular weight of 389.52 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate is sourced from PubChem (CID 609789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).