C12H21ClN2 — CID 60979508
1-[(E)-3-chloroprop-2-enyl]-3-pyrrolidin-2-ylpiperidine (PubChem CID 60979508) has the molecular formula C12H21ClN2 and a molecular weight of 228.77 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-3-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-3-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 60979508 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-3-pyrrolidin-2-ylpiperidine |
| SMILES | Cl/C=C/CN1CCCC(C2CCCN2)C1 |
| InChI | InChI=1S/C12H21ClN2/c13-6-3-9-15-8-2-4-11(10-15)12-5-1-7-14-12/h3,6,11-12,14H,1-2,4-5,7-10H2/b6-3+ |
| InChIKey | PBJVENMRFVYUCE-ZZXKWVIFSA-N |
| XLogP | 2.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |