About benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+)
benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) (PubChem CID 6098031) has the molecular formula C18H14BiClS2
and a molecular weight of 538.88 g/mol. Its IUPAC name is benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+).
Molecular Properties
| Compound Name | benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) |
| PubChem CID | 6098031 |
| Molecular Formula | C18H14BiClS2 |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) |
| SMILES | Clc1ccc([Bi+2])cc1.[S-]c1ccccc1.[S-]c1ccccc1 |
| InChI | InChI=1S/C6H4Cl.2C6H6S.Bi/c3*7-6-4-2-1-3-5-6;/h2-5H;2*1-5,7H;/q;;;+2/p-2 |
| InChIKey | KJSGEHYKDGHCOU-UHFFFAOYSA-L |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+)?
The IUPAC name of benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) (CID 6098031) is benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+).
What is the SMILES notation for benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+)?
The canonical SMILES for benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) is Clc1ccc([Bi+2])cc1.[S-]c1ccccc1.[S-]c1ccccc1.
What is the InChIKey of benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+)?
The InChIKey is KJSGEHYKDGHCOU-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H4Cl.2C6H6S.Bi/c3*7-6-4-2-1-3-5-6;/h2-5H;2*1-5,7H;/q;;;+2/p-2.
What are the key properties of benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+)?
benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) has a molecular weight of 538.88 g/mol, XLogP of 4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiolate;(4-chlorophenyl)-dihydridobismuth(2+) is sourced from PubChem (CID 6098031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).