C9H10BrClN2O — CID 60981700
1-(5-bromo-2-chlorophenyl)-3-ethylurea (PubChem CID 60981700) has the molecular formula C9H10BrClN2O and a molecular weight of 277.55 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-3-ethylurea.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-3-ethylurea |
|---|---|
| PubChem CID | 60981700 |
| Molecular Formula | C9H10BrClN2O |
| Molecular Weight | 277.55 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C9H10BrClN2O/c1-2-12-9(14)13-8-5-6(10)3-4-7(8)11/h3-5H,2H2,1H3,(H2,12,13,14) |
| InChIKey | QIEPIEPWILFRAZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |