About 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol
4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol (PubChem CID 60981808) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol |
| PubChem CID | 60981808 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol |
| SMILES | CCc1ncc(CNC2CCC(O)CC2)s1 |
| InChI | InChI=1S/C12H20N2OS/c1-2-12-14-8-11(16-12)7-13-9-3-5-10(15)6-4-9/h8-10,13,15H,2-7H2,1H3 |
| InChIKey | QHPRQSPDWFCPMK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol?
The IUPAC name of 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol (CID 60981808) is 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol?
The canonical SMILES for 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol is CCc1ncc(CNC2CCC(O)CC2)s1.
What is the InChIKey of 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol?
The InChIKey is QHPRQSPDWFCPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2OS/c1-2-12-14-8-11(16-12)7-13-9-3-5-10(15)6-4-9/h8-10,13,15H,2-7H2,1H3.
What are the key properties of 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol?
4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol has a molecular weight of 240.37 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]cyclohexan-1-ol is sourced from PubChem (CID 60981808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).